C21H35ClN4O2 — CID 168818865
4-(5-chloro-6-oxodiazinan-4-yl)-1-[(2-cyclohexylcyclohexyl)methyl]piperazin-2-one (PubChem CID 168818865) has the molecular formula C21H35ClN4O2 and a molecular weight of 410.99 g/mol. Its IUPAC name is 4-(5-chloro-6-oxodiazinan-4-yl)-1-[(2-cyclohexylcyclohexyl)methyl]piperazin-2-one.
| Compound Name | 4-(5-chloro-6-oxodiazinan-4-yl)-1-[(2-cyclohexylcyclohexyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 168818865 |
| Molecular Formula | C21H35ClN4O2 |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-(5-chloro-6-oxodiazinan-4-yl)-1-[(2-cyclohexylcyclohexyl)methyl]piperazin-2-one |
| SMILES | O=C1NNCC(N2CCN(CC3CCCCC3C3CCCCC3)C(=O)C2)C1Cl |
| InChI | InChI=1S/C21H35ClN4O2/c22-20-18(12-23-24-21(20)28)25-10-11-26(19(27)14-25)13-16-8-4-5-9-17(16)15-6-2-1-3-7-15/h15-18,20,23H,1-14H2,(H,24,28) |
| InChIKey | QEPHENXKMKQLME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|