C20H34ClF3N6O — CID 138484483
4-chloro-5-[1-[[1-ethyl-2-(2,2,2-trifluoroethyl)piperidin-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one (PubChem CID 138484483) has the molecular formula C20H34ClF3N6O and a molecular weight of 466.98 g/mol. Its IUPAC name is 4-chloro-5-[1-[[1-ethyl-2-(2,2,2-trifluoroethyl)piperidin-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[1-[[1-ethyl-2-(2,2,2-trifluoroethyl)piperidin-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one |
|---|---|
| PubChem CID | 138484483 |
| Molecular Formula | C20H34ClF3N6O |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 4-chloro-5-[1-[[1-ethyl-2-(2,2,2-trifluoroethyl)piperidin-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one |
| SMILES | CCN1CCCC(CN2NCC3CN(C4CNNC(=O)C4Cl)CCC32)C1CC(F)(F)F |
| InChI | InChI=1S/C20H34ClF3N6O/c1-2-28-6-3-4-13(16(28)8-20(22,23)24)12-30-15-5-7-29(11-14(15)9-26-30)17-10-25-27-19(31)18(17)21/h13-18,25-26H,2-12H2,1H3,(H,27,31) |
| InChIKey | XFQQUZQFRHBGGQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|