C17H27ClF3N5O — CID 168818852
4-chloro-5-[2-[2-(trifluoromethyl)cyclohexyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one (PubChem CID 168818852) has the molecular formula C17H27ClF3N5O and a molecular weight of 409.88 g/mol. Its IUPAC name is 4-chloro-5-[2-[2-(trifluoromethyl)cyclohexyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[2-[2-(trifluoromethyl)cyclohexyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one |
|---|---|
| PubChem CID | 168818852 |
| Molecular Formula | C17H27ClF3N5O |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-chloro-5-[2-[2-(trifluoromethyl)cyclohexyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-5-yl]diazinan-3-one |
| SMILES | O=C1NNCC(N2CCC3NN(C4CCCCC4C(F)(F)F)CC3C2)C1Cl |
| InChI | InChI=1S/C17H27ClF3N5O/c18-15-14(7-22-23-16(15)27)25-6-5-12-10(8-25)9-26(24-12)13-4-2-1-3-11(13)17(19,20)21/h10-15,22,24H,1-9H2,(H,23,27) |
| InChIKey | XRBJMLOFPFOPQL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|