C18H27N7O — CID 142546860
5-[3-(2-cyanocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile (PubChem CID 142546860) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 5-[3-(2-cyanocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile.
| Compound Name | 5-[3-(2-cyanocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile |
|---|---|
| PubChem CID | 142546860 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 5-[3-(2-cyanocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile |
| SMILES | N#CC1CCCCC1N1CNC2CCN(C3CNNC(=O)C3C#N)CC21 |
| InChI | InChI=1S/C18H27N7O/c19-7-12-3-1-2-4-15(12)25-11-21-14-5-6-24(10-17(14)25)16-9-22-23-18(26)13(16)8-20/h12-17,21-22H,1-6,9-11H2,(H,23,26) |
| InChIKey | ZRFOLHDOFQMVLD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |