C16H26ClF3N6O — CID 138484226
4-chloro-5-[1-[2-(trifluoromethyl)piperidin-3-yl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one (PubChem CID 138484226) has the molecular formula C16H26ClF3N6O and a molecular weight of 410.87 g/mol. Its IUPAC name is 4-chloro-5-[1-[2-(trifluoromethyl)piperidin-3-yl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[1-[2-(trifluoromethyl)piperidin-3-yl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one |
|---|---|
| PubChem CID | 138484226 |
| Molecular Formula | C16H26ClF3N6O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-chloro-5-[1-[2-(trifluoromethyl)piperidin-3-yl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one |
| SMILES | O=C1NNCC(N2CCC3C(C2)NCN3C2CCCNC2C(F)(F)F)C1Cl |
| InChI | InChI=1S/C16H26ClF3N6O/c17-13-12(6-23-24-15(13)27)25-5-3-10-9(7-25)22-8-26(10)11-2-1-4-21-14(11)16(18,19)20/h9-14,21-23H,1-8H2,(H,24,27) |
| InChIKey | OMGWZTHGMSEFCL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|