C18H32ClN5O — CID 168818606
4-chloro-5-[1-[(2-methylcyclohexyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one (PubChem CID 168818606) has the molecular formula C18H32ClN5O and a molecular weight of 369.94 g/mol. Its IUPAC name is 4-chloro-5-[1-[(2-methylcyclohexyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[1-[(2-methylcyclohexyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one |
|---|---|
| PubChem CID | 168818606 |
| Molecular Formula | C18H32ClN5O |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-chloro-5-[1-[(2-methylcyclohexyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-imidazo[4,5-c]pyridin-5-yl]diazinan-3-one |
| SMILES | CC1CCCCC1CN1CNC2CN(C3CNNC(=O)C3Cl)CCC21 |
| InChI | InChI=1S/C18H32ClN5O/c1-12-4-2-3-5-13(12)9-24-11-20-14-10-23(7-6-15(14)24)16-8-21-22-18(25)17(16)19/h12-17,20-21H,2-11H2,1H3,(H,22,25) |
| InChIKey | OPBSFTVHLZVWPV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|