C17H31ClN4O — CID 168818910
4-chloro-5-[4-[(1S)-1-(2-methylcyclohexyl)ethyl]piperazin-1-yl]diazinan-3-one (PubChem CID 168818910) has the molecular formula C17H31ClN4O and a molecular weight of 342.92 g/mol. Its IUPAC name is 4-chloro-5-[4-[(1S)-1-(2-methylcyclohexyl)ethyl]piperazin-1-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[4-[(1S)-1-(2-methylcyclohexyl)ethyl]piperazin-1-yl]diazinan-3-one |
|---|---|
| PubChem CID | 168818910 |
| Molecular Formula | C17H31ClN4O |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-chloro-5-[4-[(1S)-1-(2-methylcyclohexyl)ethyl]piperazin-1-yl]diazinan-3-one |
| SMILES | CC1CCCCC1[C@H](C)N1CCN(C2CNNC(=O)C2Cl)CC1 |
| InChI | InChI=1S/C17H31ClN4O/c1-12-5-3-4-6-14(12)13(2)21-7-9-22(10-8-21)15-11-19-20-17(23)16(15)18/h12-16,19H,3-11H2,1-2H3,(H,20,23)/t12?,13-,14?,15?,16?/m0/s1 |
| InChIKey | MTEMFMFQGZNAJJ-KHXRNHLQSA-N |
| XLogP | 1.43 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|