C16H21ClN4O3 — CID 74259864
benzyl 4-(5-chloro-6-oxodiazinan-4-yl)piperazine-1-carboxylate (PubChem CID 74259864) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is benzyl 4-(5-chloro-6-oxodiazinan-4-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(5-chloro-6-oxodiazinan-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74259864 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | benzyl 4-(5-chloro-6-oxodiazinan-4-yl)piperazine-1-carboxylate |
| SMILES | O=C1NNCC(N2CCN(C(=O)OCc3ccccc3)CC2)C1Cl |
| InChI | InChI=1S/C16H21ClN4O3/c17-14-13(10-18-19-15(14)22)20-6-8-21(9-7-20)16(23)24-11-12-4-2-1-3-5-12/h1-5,13-14,18H,6-11H2,(H,19,22) |
| InChIKey | OPDGQFCEWBHXRA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|