C21H34N4O3 — CID 168818630
4-[5-(3,6-dihydro-2H-pyran-4-yl)-6-oxodiazinan-4-yl]-1-[(2-methylcyclohexyl)methyl]piperazin-2-one (PubChem CID 168818630) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[5-(3,6-dihydro-2H-pyran-4-yl)-6-oxodiazinan-4-yl]-1-[(2-methylcyclohexyl)methyl]piperazin-2-one.
| Compound Name | 4-[5-(3,6-dihydro-2H-pyran-4-yl)-6-oxodiazinan-4-yl]-1-[(2-methylcyclohexyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 168818630 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 4-[5-(3,6-dihydro-2H-pyran-4-yl)-6-oxodiazinan-4-yl]-1-[(2-methylcyclohexyl)methyl]piperazin-2-one |
| SMILES | CC1CCCCC1CN1CCN(C2CNNC(=O)C2C2=CCOCC2)CC1=O |
| InChI | InChI=1S/C21H34N4O3/c1-15-4-2-3-5-17(15)13-25-9-8-24(14-19(25)26)18-12-22-23-21(27)20(18)16-6-10-28-11-7-16/h6,15,17-18,20,22H,2-5,7-14H2,1H3,(H,23,27) |
| InChIKey | PWWFWUHBTJIHGX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|