C17H28ClFN4O2 — CID 147782168
(5R)-4-(5-chloro-6-oxodiazinan-4-yl)-1-[(4-fluoro-2-methylcyclohexyl)methyl]-5-methylpiperazin-2-one (PubChem CID 147782168) has the molecular formula C17H28ClFN4O2 and a molecular weight of 374.89 g/mol. Its IUPAC name is (5R)-4-(5-chloro-6-oxodiazinan-4-yl)-1-[(4-fluoro-2-methylcyclohexyl)methyl]-5-methylpiperazin-2-one.
| Compound Name | (5R)-4-(5-chloro-6-oxodiazinan-4-yl)-1-[(4-fluoro-2-methylcyclohexyl)methyl]-5-methylpiperazin-2-one |
|---|---|
| PubChem CID | 147782168 |
| Molecular Formula | C17H28ClFN4O2 |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (5R)-4-(5-chloro-6-oxodiazinan-4-yl)-1-[(4-fluoro-2-methylcyclohexyl)methyl]-5-methylpiperazin-2-one |
| SMILES | CC1CC(F)CCC1CN1C[C@@H](C)N(C2CNNC(=O)C2Cl)CC1=O |
| InChI | InChI=1S/C17H28ClFN4O2/c1-10-5-13(19)4-3-12(10)8-22-7-11(2)23(9-15(22)24)14-6-20-21-17(25)16(14)18/h10-14,16,20H,3-9H2,1-2H3,(H,21,25)/t10?,11-,12?,13?,14?,16?/m1/s1 |
| InChIKey | GAIHQTAPRFPJPL-SDEKHGLNSA-N |
| XLogP | 0.90 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|