C12H13Li — CID 140544977
lithium 1-propan-2-yl-1,2-dihydroinden-2-ide (PubChem CID 140544977) has the molecular formula C12H13Li and a molecular weight of 164.18 g/mol. Its IUPAC name is lithium 1-propan-2-yl-1,2-dihydroinden-2-ide.
| Compound Name | lithium 1-propan-2-yl-1,2-dihydroinden-2-ide |
|---|---|
| PubChem CID | 140544977 |
| Molecular Formula | C12H13Li |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | lithium 1-propan-2-yl-1,2-dihydroinden-2-ide |
| SMILES | CC(C)C1[C-]=Cc2ccccc21.[Li+] |
| InChI | InChI=1S/C12H13.Li/c1-9(2)11-8-7-10-5-3-4-6-12(10)11;/h3-7,9,11H,1-2H3;/q-1;+1 |
| InChIKey | VTQYNXZGWYHYQL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|