C13H15Li — CID 86706728
lithium 1-butyl-1,2-dihydroinden-2-ide (PubChem CID 86706728) has the molecular formula C13H15Li and a molecular weight of 178.20 g/mol. Its IUPAC name is lithium 1-butyl-1,2-dihydroinden-2-ide.
| Compound Name | lithium 1-butyl-1,2-dihydroinden-2-ide |
|---|---|
| PubChem CID | 86706728 |
| Molecular Formula | C13H15Li |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | lithium 1-butyl-1,2-dihydroinden-2-ide |
| SMILES | CCCCC1[C-]=Cc2ccccc21.[Li+] |
| InChI | InChI=1S/C13H15.Li/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12;/h4-5,7-8,10-11H,2-3,6H2,1H3;/q-1;+1 |
| InChIKey | NQSMXRUIQUBXFA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|