C40H30O2Ti — CID 2755404
1-[2-(1,2-dihydroinden-2-id-1-yl)ethyl]-1,2-dihydroinden-2-ide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) (PubChem CID 2755404) has the molecular formula C40H30O2Ti and a molecular weight of 590.55 g/mol. Its IUPAC name is 1-[2-(1,2-dihydroinden-2-id-1-yl)ethyl]-1,2-dihydroinden-2-ide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+).
| Compound Name | 1-[2-(1,2-dihydroinden-2-id-1-yl)ethyl]-1,2-dihydroinden-2-ide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) |
|---|---|
| PubChem CID | 2755404 |
| Molecular Formula | C40H30O2Ti |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 1-[2-(1,2-dihydroinden-2-id-1-yl)ethyl]-1,2-dihydroinden-2-ide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) |
| SMILES | Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12.[C-]1=Cc2ccccc2C1CCC1[C-]=Cc2ccccc21.[Ti+2] |
| InChI | InChI=1S/C20H14O2.C20H16.Ti/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;/h1-12,21-22H;1-10,17-18H,13-14H2;/q;-2;+2 |
| InChIKey | JQTXUSHURVFNAT-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|