C20H12Cl2O2Ti — CID 88689430
3,4-dichloro-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium (PubChem CID 88689430) has the molecular formula C20H12Cl2O2Ti and a molecular weight of 403.09 g/mol. Its IUPAC name is 3,4-dichloro-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium.
| Compound Name | 3,4-dichloro-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium |
|---|---|
| PubChem CID | 88689430 |
| Molecular Formula | C20H12Cl2O2Ti |
| Molecular Weight | 403.09 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 3,4-dichloro-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium |
| SMILES | Oc1ccc2ccccc2c1-c1c(O)c(Cl)c(Cl)c2ccccc12.[Ti] |
| InChI | InChI=1S/C20H12Cl2O2.Ti/c21-18-14-8-4-3-7-13(14)17(20(24)19(18)22)16-12-6-2-1-5-11(12)9-10-15(16)23;/h1-10,23-24H; |
| InChIKey | NIPHFOJKTPZHMP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.09 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |