C22H22Zr — CID 140556750
ethylidenezirconium(2+);bis(1-methyl-1,2-dihydroinden-2-ide) (PubChem CID 140556750) has the molecular formula C22H22Zr and a molecular weight of 377.64 g/mol. Its IUPAC name is ethylidenezirconium(2+);bis(1-methyl-1,2-dihydroinden-2-ide).
| Compound Name | ethylidenezirconium(2+);bis(1-methyl-1,2-dihydroinden-2-ide) |
|---|---|
| PubChem CID | 140556750 |
| Molecular Formula | C22H22Zr |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | ethylidenezirconium(2+);bis(1-methyl-1,2-dihydroinden-2-ide) |
| SMILES | CC1[C-]=Cc2ccccc21.CC1[C-]=Cc2ccccc21.CC=[Zr+2] |
| InChI | InChI=1S/2C10H9.C2H4.Zr/c2*1-8-6-7-9-4-2-3-5-10(8)9;1-2;/h2*2-5,7-8H,1H3;1H,2H3;/q2*-1;;+2 |
| InChIKey | KNFBGGIQFSBCFI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|