C9H19NOS — CID 140545356
(3S,4R)-1-methyl-4-(propylsulfanylmethyl)pyrrolidin-3-ol (PubChem CID 140545356) has the molecular formula C9H19NOS and a molecular weight of 189.32 g/mol. Its IUPAC name is (3S,4R)-1-methyl-4-(propylsulfanylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-methyl-4-(propylsulfanylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 140545356 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3S,4R)-1-methyl-4-(propylsulfanylmethyl)pyrrolidin-3-ol |
| SMILES | CCCSC[C@@H]1CN(C)C[C@H]1O |
| InChI | InChI=1S/C9H19NOS/c1-3-4-12-7-8-5-10(2)6-9(8)11/h8-9,11H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | WMMBSTVIKPWTKL-DTWKUNHWSA-N |
| XLogP | 1.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|