C22H25N5O3 — CID 140548626
N-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-2-(5-methyl-1-phenylpyrazol-3-yl)acetamide (PubChem CID 140548626) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-2-(5-methyl-1-phenylpyrazol-3-yl)acetamide.
| Compound Name | N-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-2-(5-methyl-1-phenylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 140548626 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-2-(5-methyl-1-phenylpyrazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NCN2CCN(C(=O)c3ccco3)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H25N5O3/c1-17-14-18(24-27(17)19-6-3-2-4-7-19)15-21(28)23-16-25-9-11-26(12-10-25)22(29)20-8-5-13-30-20/h2-8,13-14H,9-12,15-16H2,1H3,(H,23,28) |
| InChIKey | USVYDFDPXPFPJJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |