C26H31F3N2O2 — CID 140549003
(2S)-1-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-phenyl-2-(2,2,2-trifluoroethylamino)propan-1-one (PubChem CID 140549003) has the molecular formula C26H31F3N2O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is (2S)-1-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-phenyl-2-(2,2,2-trifluoroethylamino)propan-1-one.
| Compound Name | (2S)-1-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-phenyl-2-(2,2,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 140549003 |
| Molecular Formula | C26H31F3N2O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (2S)-1-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-phenyl-2-(2,2,2-trifluoroethylamino)propan-1-one |
| SMILES | O=C([C@H](Cc1ccccc1)NCC(F)(F)F)N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C26H31F3N2O2/c27-26(28,29)18-30-22(17-19-9-3-1-4-10-19)24(32)31-16-15-25(33,20-11-5-2-6-12-20)21-13-7-8-14-23(21)31/h1-6,9-12,21-23,30,33H,7-8,13-18H2/t21-,22+,23+,25?/m1/s1 |
| InChIKey | SQEVKIMTQXKWFB-ICIDBNQLSA-N |
| XLogP | 4.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |