C25H30F3N3O2 — CID 59285661
(2S)-1-[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-pyridin-3-yl-2-(2,2,2-trifluoroethylamino)propan-1-one (PubChem CID 59285661) has the molecular formula C25H30F3N3O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is (2S)-1-[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-pyridin-3-yl-2-(2,2,2-trifluoroethylamino)propan-1-one.
| Compound Name | (2S)-1-[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-pyridin-3-yl-2-(2,2,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 59285661 |
| Molecular Formula | C25H30F3N3O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-1-[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-3-pyridin-3-yl-2-(2,2,2-trifluoroethylamino)propan-1-one |
| SMILES | O=C([C@H](Cc1cccnc1)NCC(F)(F)F)N1CC[C@](O)(c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C25H30F3N3O2/c26-25(27,28)17-30-21(15-18-7-6-13-29-16-18)23(32)31-14-12-24(33,19-8-2-1-3-9-19)20-10-4-5-11-22(20)31/h1-3,6-9,13,16,20-22,30,33H,4-5,10-12,14-15,17H2/t20-,21-,22+,24-/m0/s1 |
| InChIKey | FZDOOOVHYQGSKZ-YCSHWKNNSA-N |
| XLogP | 3.82 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |