C27H38F3N3O4 — CID 140548960
tert-butyl 3-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 140548960) has the molecular formula C27H38F3N3O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is tert-butyl 3-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140548960 |
| Molecular Formula | C27H38F3N3O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | tert-butyl 3-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)C(C(=O)N2CCC(O)(c3ccccc3)[C@@H]3CCCC[C@@H]32)C1 |
| InChI | InChI=1S/C27H38F3N3O4/c1-25(2,3)37-24(35)31-15-16-32(18-27(28,29)30)22(17-31)23(34)33-14-13-26(36,19-9-5-4-6-10-19)20-11-7-8-12-21(20)33/h4-6,9-10,20-22,36H,7-8,11-18H2,1-3H3/t20-,21+,22?,26?/m1/s1 |
| InChIKey | JETDTWVNVKVTLU-KRMKOYIXSA-N |
| XLogP | 4.15 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |