C34H43N3O5 — CID 133111057
4-[3-[(4R,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]piperidin-1-yl]-2-(2-methoxy-2-methylpropyl)isoindole-1,3-dione (PubChem CID 133111057) has the molecular formula C34H43N3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is 4-[3-[(4R,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]piperidin-1-yl]-2-(2-methoxy-2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 4-[3-[(4R,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]piperidin-1-yl]-2-(2-methoxy-2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 133111057 |
| Molecular Formula | C34H43N3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | 4-[3-[(4R,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]piperidin-1-yl]-2-(2-methoxy-2-methylpropyl)isoindole-1,3-dione |
| SMILES | COC(C)(C)CN1C(=O)c2cccc(N3CCCC(C(=O)N4CC[C@](O)(c5ccccc5)[C@@H]5CCCC[C@@H]54)C3)c2C1=O |
| InChI | InChI=1S/C34H43N3O5/c1-33(2,42-3)22-37-31(39)25-14-9-17-28(29(25)32(37)40)35-19-10-11-23(21-35)30(38)36-20-18-34(41,24-12-5-4-6-13-24)26-15-7-8-16-27(26)36/h4-6,9,12-14,17,23,26-27,41H,7-8,10-11,15-16,18-22H2,1-3H3/t23?,26-,27+,34+/m1/s1 |
| InChIKey | KXXHBFLBZCYGNB-FGANIGRLSA-N |
| XLogP | 4.60 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|