C24H26N4O2 — CID 59285551
[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-pyridin-4-yl-1H-pyrazol-5-yl)methanone (PubChem CID 59285551) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-pyridin-4-yl-1H-pyrazol-5-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-pyridin-4-yl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 59285551 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-pyridin-4-yl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccncc2)n[nH]1)N1CC[C@](O)(c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C24H26N4O2/c29-23(21-16-20(26-27-21)17-10-13-25-14-11-17)28-15-12-24(30,18-6-2-1-3-7-18)19-8-4-5-9-22(19)28/h1-3,6-7,10-11,13-14,16,19,22,30H,4-5,8-9,12,15H2,(H,26,27)/t19-,22+,24-/m0/s1 |
| InChIKey | WICKLHSBRDMEMJ-KWOQKUFVSA-N |
| XLogP | 3.76 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |