C21H23ClN6O4 — CID 140550545
[2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-3-(methoxycarbamoyl)phenyl] formate (PubChem CID 140550545) has the molecular formula C21H23ClN6O4 and a molecular weight of 458.91 g/mol. Its IUPAC name is [2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-3-(methoxycarbamoyl)phenyl] formate.
| Compound Name | [2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-3-(methoxycarbamoyl)phenyl] formate |
|---|---|
| PubChem CID | 140550545 |
| Molecular Formula | C21H23ClN6O4 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-3-(methoxycarbamoyl)phenyl] formate |
| SMILES | CONC(=O)c1cccc(OC=O)c1Nc1cc(Nc2cc(C)nn2C(C)C)ncc1Cl |
| InChI | InChI=1S/C21H23ClN6O4/c1-12(2)28-19(8-13(3)26-28)25-18-9-16(15(22)10-23-18)24-20-14(21(30)27-31-4)6-5-7-17(20)32-11-29/h5-12H,1-4H3,(H,27,30)(H2,23,24,25) |
| InChIKey | FIGYOWVVZQJMIS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|