C21H25ClN6O2 — CID 46215100
2-[[5-chloro-2-[[4-methyl-1-(2-methylpropyl)pyrazol-5-yl]amino]-4-pyridinyl]amino]-N-methoxybenzamide (PubChem CID 46215100) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-[[5-chloro-2-[[4-methyl-1-(2-methylpropyl)pyrazol-5-yl]amino]-4-pyridinyl]amino]-N-methoxybenzamide.
| Compound Name | 2-[[5-chloro-2-[[4-methyl-1-(2-methylpropyl)pyrazol-5-yl]amino]-4-pyridinyl]amino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 46215100 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[[5-chloro-2-[[4-methyl-1-(2-methylpropyl)pyrazol-5-yl]amino]-4-pyridinyl]amino]-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccccc1Nc1cc(Nc2c(C)cnn2CC(C)C)ncc1Cl |
| InChI | InChI=1S/C21H25ClN6O2/c1-13(2)12-28-20(14(3)10-24-28)26-19-9-18(16(22)11-23-19)25-17-8-6-5-7-15(17)21(29)27-30-4/h5-11,13H,12H2,1-4H3,(H,27,29)(H2,23,25,26) |
| InChIKey | MRJXSKFDGGGXTE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|