C19H20ClN5O2 — CID 135163292
2-[[5-chloro-2-[(1,4-dimethylpyrrol-2-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide (PubChem CID 135163292) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(1,4-dimethylpyrrol-2-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide.
| Compound Name | 2-[[5-chloro-2-[(1,4-dimethylpyrrol-2-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 135163292 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[[5-chloro-2-[(1,4-dimethylpyrrol-2-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccccc1Nc1cc(Nc2cc(C)cn2C)ncc1Cl |
| InChI | InChI=1S/C19H20ClN5O2/c1-12-8-18(25(2)11-12)23-17-9-16(14(20)10-21-17)22-15-7-5-4-6-13(15)19(26)24-27-3/h4-11H,1-3H3,(H,24,26)(H2,21,22,23) |
| InChIKey | MPWUMFWEDVQILR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|