C16H21NO — CID 140552590
N-phenylmethoxytricyclo[3.3.1.03,7]nonan-2-amine (PubChem CID 140552590) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-phenylmethoxytricyclo[3.3.1.03,7]nonan-2-amine.
| Compound Name | N-phenylmethoxytricyclo[3.3.1.03,7]nonan-2-amine |
|---|---|
| PubChem CID | 140552590 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-phenylmethoxytricyclo[3.3.1.03,7]nonan-2-amine |
| SMILES | c1ccc(CONC2C3CC4CC(C3)C2C4)cc1 |
| InChI | InChI=1S/C16H21NO/c1-2-4-11(5-3-1)10-18-17-16-14-7-12-6-13(9-14)15(16)8-12/h1-5,12-17H,6-10H2 |
| InChIKey | XZRUOPLDKLWQBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|