C19H24N2O3 — CID 140562324
N-hydroxy-4,6-dimethyl-7-oxo-7-(4-pyrrolidin-1-ylphenyl)hepta-2,4-dienamide (PubChem CID 140562324) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-hydroxy-4,6-dimethyl-7-oxo-7-(4-pyrrolidin-1-ylphenyl)hepta-2,4-dienamide.
| Compound Name | N-hydroxy-4,6-dimethyl-7-oxo-7-(4-pyrrolidin-1-ylphenyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 140562324 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-hydroxy-4,6-dimethyl-7-oxo-7-(4-pyrrolidin-1-ylphenyl)hepta-2,4-dienamide |
| SMILES | CC(C=CC(=O)NO)=CC(C)C(=O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-14(5-10-18(22)20-24)13-15(2)19(23)16-6-8-17(9-7-16)21-11-3-4-12-21/h5-10,13,15,24H,3-4,11-12H2,1-2H3,(H,20,22) |
| InChIKey | OETVLWZBCYWGJE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|