C9H5F3N4 — CID 140566232
3-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 140566232) has the molecular formula C9H5F3N4 and a molecular weight of 226.16 g/mol. Its IUPAC name is 3-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 140566232 |
| Molecular Formula | C9H5F3N4 |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | FC(F)(F)n1cnc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C9H5F3N4/c10-9(11,12)16-4-15-6-3-14-8-5(7(6)16)1-2-13-8/h1-4H,(H,13,14) |
| InChIKey | HCMUEAHADDNJFJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |