C15H15F3N6O — CID 166936433
1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-1-en-2-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 166936433) has the molecular formula C15H15F3N6O and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-1-en-2-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-1-en-2-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 166936433 |
| Molecular Formula | C15H15F3N6O |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-1-en-2-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | C=C(CCn1cnc2cnc3[nH]ccc3c21)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H15F3N6O/c1-9(23-14(25)21-7-15(16,17)18)3-5-24-8-22-11-6-20-13-10(12(11)24)2-4-19-13/h2,4,6,8H,1,3,5,7H2,(H,19,20)(H2,21,23,25) |
| InChIKey | IOBJDVQCBHDKQW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |