C16H21N5O2S — CID 166936382
2-methyl-N-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-3-enyl]propane-1-sulfonamide (PubChem CID 166936382) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-methyl-N-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-3-enyl]propane-1-sulfonamide.
| Compound Name | 2-methyl-N-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-3-enyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 166936382 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-methyl-N-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)but-3-enyl]propane-1-sulfonamide |
| SMILES | C=C(CCNS(=O)(=O)CC(C)C)n1cnc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C16H21N5O2S/c1-11(2)9-24(22,23)20-7-4-12(3)21-10-19-14-8-18-16-13(15(14)21)5-6-17-16/h5-6,8,10-11,20H,3-4,7,9H2,1-2H3,(H,17,18) |
| InChIKey | LGSFMUFVPGKAPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |