About N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide
N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide (PubChem CID 140577346) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide |
| PubChem CID | 140577346 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide |
| SMILES | CC(=O)N(C)[C@H]1CCC[C@@H](N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C14H27N3O/c1-12(18)16(3)13-5-4-6-14(11-13)17-9-7-15(2)8-10-17/h13-14H,4-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | RFXHVJLXFAVNOP-UONOGXRCSA-N |
| XLogP | 1.02 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide?
The IUPAC name of N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide (CID 140577346) is N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide.
What is the SMILES notation for N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide?
The canonical SMILES for N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide is CC(=O)N(C)[C@H]1CCC[C@@H](N2CCN(C)CC2)C1.
What is the InChIKey of N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide?
The InChIKey is RFXHVJLXFAVNOP-UONOGXRCSA-N. The full InChI is InChI=1S/C14H27N3O/c1-12(18)16(3)13-5-4-6-14(11-13)17-9-7-15(2)8-10-17/h13-14H,4-11H2,1-3H3/t13-,14+/m0/s1.
What are the key properties of N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide?
N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide has a molecular weight of 253.39 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1S,3R)-3-(4-methylpiperazin-1-yl)cyclohexyl]acetamide is sourced from PubChem (CID 140577346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).