C7H16KN2O+ — CID 140577616
potassium (1Z)-N-(dimethylazaniumyl)-2,2-dimethylpropanimidate (PubChem CID 140577616) has the molecular formula C7H16KN2O+ and a molecular weight of 183.32 g/mol. Its IUPAC name is potassium (1Z)-N-(dimethylazaniumyl)-2,2-dimethylpropanimidate.
| Compound Name | potassium (1Z)-N-(dimethylazaniumyl)-2,2-dimethylpropanimidate |
|---|---|
| PubChem CID | 140577616 |
| Molecular Formula | C7H16KN2O+ |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | potassium (1Z)-N-(dimethylazaniumyl)-2,2-dimethylpropanimidate |
| SMILES | C[NH+](C)/N=C(\[O-])C(C)(C)C.[K+] |
| InChI | InChI=1S/C7H16N2O.K/c1-7(2,3)6(10)8-9(4)5;/h1-5H3,(H,8,10);/q;+1 |
| InChIKey | SYVOVJPDSFBPLG-UHFFFAOYSA-N |
| XLogP | -4.15 |
| TPSA | 39.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|