C17H17F3N2O2 — CID 140578768
2-(3,3,3-trifluoro-2-propan-2-yloxyiminopropyl)naphthalene-1-carboxamide (PubChem CID 140578768) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-(3,3,3-trifluoro-2-propan-2-yloxyiminopropyl)naphthalene-1-carboxamide.
| Compound Name | 2-(3,3,3-trifluoro-2-propan-2-yloxyiminopropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578768 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(3,3,3-trifluoro-2-propan-2-yloxyiminopropyl)naphthalene-1-carboxamide |
| SMILES | CC(C)ON=C(Cc1ccc2ccccc2c1C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O2/c1-10(2)24-22-14(17(18,19)20)9-12-8-7-11-5-3-4-6-13(11)15(12)16(21)23/h3-8,10H,9H2,1-2H3,(H2,21,23) |
| InChIKey | IOXTVWWPQJRYJY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|