C19H17F3N2O3 — CID 140579525
5-phenyl-1-(trifluoromethyl)-3-(3,4,5-trimethoxyphenyl)pyrazole (PubChem CID 140579525) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 5-phenyl-1-(trifluoromethyl)-3-(3,4,5-trimethoxyphenyl)pyrazole.
| Compound Name | 5-phenyl-1-(trifluoromethyl)-3-(3,4,5-trimethoxyphenyl)pyrazole |
|---|---|
| PubChem CID | 140579525 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 5-phenyl-1-(trifluoromethyl)-3-(3,4,5-trimethoxyphenyl)pyrazole |
| SMILES | COc1cc(-c2cc(-c3ccccc3)n(C(F)(F)F)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17F3N2O3/c1-25-16-9-13(10-17(26-2)18(16)27-3)14-11-15(12-7-5-4-6-8-12)24(23-14)19(20,21)22/h4-11H,1-3H3 |
| InChIKey | SHXUAZUNSBZVCE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |