C14H14BrF3S — CID 140581892
1-bromo-2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581892) has the molecular formula C14H14BrF3S and a molecular weight of 351.23 g/mol. Its IUPAC name is 1-bromo-2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 1-bromo-2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 140581892 |
| Molecular Formula | C14H14BrF3S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 1-bromo-2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | FC(F)(F)S1(Br)C(C2CCCC2)=Cc2ccccc21 |
| InChI | InChI=1S/C14H14BrF3S/c15-19(14(16,17)18)12-8-4-3-7-11(12)9-13(19)10-5-1-2-6-10/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | VCKRXCNMIAQZJZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |