C15H14F6O3S2 — CID 140582037
[2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 140582037) has the molecular formula C15H14F6O3S2 and a molecular weight of 420.40 g/mol. Its IUPAC name is [2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140582037 |
| Molecular Formula | C15H14F6O3S2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS1(C(F)(F)F)C(C2CCCC2)=Cc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C15H14F6O3S2/c16-14(17,18)25(24-26(22,23)15(19,20)21)12-8-4-3-7-11(12)9-13(25)10-5-1-2-6-10/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | LWCFWECMOBLMCJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|