C19H16F6O3S2 — CID 87943352
[2-phenyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 87943352) has the molecular formula C19H16F6O3S2 and a molecular weight of 470.46 g/mol. Its IUPAC name is [2-phenyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-phenyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87943352 |
| Molecular Formula | C19H16F6O3S2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | [2-phenyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | CCCc1ccc2c(c1)S(OS(=O)(=O)C(F)(F)F)(C(F)(F)F)C(c1ccccc1)=C2 |
| InChI | InChI=1S/C19H16F6O3S2/c1-2-6-13-9-10-15-12-17(14-7-4-3-5-8-14)29(16(15)11-13,18(20,21)22)28-30(26,27)19(23,24)25/h3-5,7-12H,2,6H2,1H3 |
| InChIKey | XJLHXNKWOVRQQV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|