C15H16ClF3S — CID 140581910
1-chloro-2-cyclopropyl-6-propyl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581910) has the molecular formula C15H16ClF3S and a molecular weight of 320.81 g/mol. Its IUPAC name is 1-chloro-2-cyclopropyl-6-propyl-1-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 1-chloro-2-cyclopropyl-6-propyl-1-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 140581910 |
| Molecular Formula | C15H16ClF3S |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-chloro-2-cyclopropyl-6-propyl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | CCCc1ccc2c(c1)S(Cl)(C(F)(F)F)C(C1CC1)=C2 |
| InChI | InChI=1S/C15H16ClF3S/c1-2-3-10-4-5-12-9-14(11-6-7-11)20(16,13(12)8-10)15(17,18)19/h4-5,8-9,11H,2-3,6-7H2,1H3 |
| InChIKey | UTOJYLAXQDKGRQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |