C16H20ClF3S — CID 140581823
6-tert-butyl-1-chloro-2-propyl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581823) has the molecular formula C16H20ClF3S and a molecular weight of 336.85 g/mol. Its IUPAC name is 6-tert-butyl-1-chloro-2-propyl-1-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 6-tert-butyl-1-chloro-2-propyl-1-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 140581823 |
| Molecular Formula | C16H20ClF3S |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 6-tert-butyl-1-chloro-2-propyl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | CCCC1=Cc2ccc(C(C)(C)C)cc2S1(Cl)C(F)(F)F |
| InChI | InChI=1S/C16H20ClF3S/c1-5-6-13-9-11-7-8-12(15(2,3)4)10-14(11)21(13,17)16(18,19)20/h7-10H,5-6H2,1-4H3 |
| InChIKey | YNJSOMYQCQKNLT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |