C14H16ClF3S — CID 140581938
1-chloro-2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581938) has the molecular formula C14H16ClF3S and a molecular weight of 308.80 g/mol. Its IUPAC name is 1-chloro-2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 1-chloro-2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 140581938 |
| Molecular Formula | C14H16ClF3S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-chloro-2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | CCC1=Cc2ccc(C(C)C)cc2S1(Cl)C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3S/c1-4-12-7-11-6-5-10(9(2)3)8-13(11)19(12,15)14(16,17)18/h5-9H,4H2,1-3H3 |
| InChIKey | AMFHIKLQXKLFMK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |