C15H16F6O3S2 — CID 87943122
[2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 87943122) has the molecular formula C15H16F6O3S2 and a molecular weight of 422.41 g/mol. Its IUPAC name is [2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87943122 |
| Molecular Formula | C15H16F6O3S2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | [2-ethyl-6-propan-2-yl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | CCC1=Cc2ccc(C(C)C)cc2S1(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H16F6O3S2/c1-4-12-7-11-6-5-10(9(2)3)8-13(11)25(12,14(16,17)18)24-26(22,23)15(19,20)21/h5-9H,4H2,1-3H3 |
| InChIKey | MBKVHFHFKSTGAB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|