C13H14ClF3O4S — CID 87943462
[2-butyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] perchlorate (PubChem CID 87943462) has the molecular formula C13H14ClF3O4S and a molecular weight of 358.77 g/mol. Its IUPAC name is [2-butyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] perchlorate.
| Compound Name | [2-butyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] perchlorate |
|---|---|
| PubChem CID | 87943462 |
| Molecular Formula | C13H14ClF3O4S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [2-butyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] perchlorate |
| SMILES | CCCCC1=Cc2ccccc2S1(O[Cl+3]([O-])([O-])[O-])C(F)(F)F |
| InChI | InChI=1S/C13H14ClF3O4S/c1-2-3-7-11-9-10-6-4-5-8-12(10)22(11,13(15,16)17)21-14(18,19)20/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | QFRWGAXGQKCRFC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |