C15H19F3O3S2 — CID 87944227
[2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] methanesulfonate (PubChem CID 87944227) has the molecular formula C15H19F3O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] methanesulfonate.
| Compound Name | [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 87944227 |
| Molecular Formula | C15H19F3O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] methanesulfonate |
| SMILES | CCCCCC1=Cc2ccccc2S1(OS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O3S2/c1-3-4-5-9-13-11-12-8-6-7-10-14(12)23(13,15(16,17)18)21-22(2,19)20/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | DIQKCSHHXQMEBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|