C16H16F6O2S — CID 87943610
[2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87943610) has the molecular formula C16H16F6O2S and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87943610 |
| Molecular Formula | C16H16F6O2S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-pentyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCC1=Cc2ccccc2S1(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H16F6O2S/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)25(12,16(20,21)22)24-14(23)15(17,18)19/h5-7,9-10H,2-4,8H2,1H3 |
| InChIKey | UKBIGHBBYYOMJM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|