C17H20F6O3S2 — CID 87943750
[2-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 87943750) has the molecular formula C17H20F6O3S2 and a molecular weight of 450.47 g/mol. Its IUPAC name is [2-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87943750 |
| Molecular Formula | C17H20F6O3S2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [2-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | CCCCC1=Cc2ccc(CCC)cc2S1(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H20F6O3S2/c1-3-5-7-14-11-13-9-8-12(6-4-2)10-15(13)27(14,16(18,19)20)26-28(24,25)17(21,22)23/h8-11H,3-7H2,1-2H3 |
| InChIKey | GGSDWCLMTXDOBZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|