C16H18F6O3S2 — CID 87943197
[2-hexyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 87943197) has the molecular formula C16H18F6O3S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is [2-hexyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-hexyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87943197 |
| Molecular Formula | C16H18F6O3S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [2-hexyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | CCCCCCC1=Cc2ccccc2S1(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H18F6O3S2/c1-2-3-4-5-9-13-11-12-8-6-7-10-14(12)26(13,15(17,18)19)25-27(23,24)16(20,21)22/h6-8,10-11H,2-5,9H2,1H3 |
| InChIKey | FRZUTLVQZTVBHL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|