C15H18ClF3S — CID 140581912
6-tert-butyl-1-chloro-2-ethyl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581912) has the molecular formula C15H18ClF3S and a molecular weight of 322.82 g/mol. Its IUPAC name is 6-tert-butyl-1-chloro-2-ethyl-1-(trifluoromethyl)-1-benzothiophene.
| Compound Name | 6-tert-butyl-1-chloro-2-ethyl-1-(trifluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 140581912 |
| Molecular Formula | C15H18ClF3S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-tert-butyl-1-chloro-2-ethyl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | CCC1=Cc2ccc(C(C)(C)C)cc2S1(Cl)C(F)(F)F |
| InChI | InChI=1S/C15H18ClF3S/c1-5-12-8-10-6-7-11(14(2,3)4)9-13(10)20(12,16)15(17,18)19/h6-9H,5H2,1-4H3 |
| InChIKey | GHIYTOVFESIHFR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |