C18H20F6O3S2 — CID 140581667
[2-cyclohexyl-6-ethyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate (PubChem CID 140581667) has the molecular formula C18H20F6O3S2 and a molecular weight of 462.48 g/mol. Its IUPAC name is [2-cyclohexyl-6-ethyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-cyclohexyl-6-ethyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140581667 |
| Molecular Formula | C18H20F6O3S2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [2-cyclohexyl-6-ethyl-1-(trifluoromethyl)-1-benzothiophen-1-yl] trifluoromethanesulfonate |
| SMILES | CCc1ccc2c(c1)S(OS(=O)(=O)C(F)(F)F)(C(F)(F)F)C(C1CCCCC1)=C2 |
| InChI | InChI=1S/C18H20F6O3S2/c1-2-12-8-9-14-11-16(13-6-4-3-5-7-13)28(15(14)10-12,17(19,20)21)27-29(25,26)18(22,23)24/h8-11,13H,2-7H2,1H3 |
| InChIKey | RNRBIBUPFOVATK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|