About 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene
1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene (PubChem CID 140581809) has the molecular formula C11H10BrF3S
and a molecular weight of 311.17 g/mol. Its IUPAC name is 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene.
Molecular Properties
| Compound Name | 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene |
| PubChem CID | 140581809 |
| Molecular Formula | C11H10BrF3S |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene |
| SMILES | CC1=Cc2cc(C)ccc2S1(Br)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3S/c1-7-3-4-10-9(5-7)6-8(2)16(10,12)11(13,14)15/h3-6H,1-2H3 |
| InChIKey | PLQDGLMEXHTHRO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene?
The IUPAC name of 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene (CID 140581809) is 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene.
What is the SMILES notation for 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene?
The canonical SMILES for 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene is CC1=Cc2cc(C)ccc2S1(Br)C(F)(F)F.
What is the InChIKey of 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene?
The InChIKey is PLQDGLMEXHTHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF3S/c1-7-3-4-10-9(5-7)6-8(2)16(10,12)11(13,14)15/h3-6H,1-2H3.
What are the key properties of 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene?
1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene has a molecular weight of 311.17 g/mol, XLogP of 5.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,5-dimethyl-1-(trifluoromethyl)-1-benzothiophene is sourced from PubChem (CID 140581809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).