C20H35N5 — CID 140583940
N,N-dimethyl-4-(1,4,7,10-tetrazacyclododec-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 140583940) has the molecular formula C20H35N5 and a molecular weight of 345.54 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,4,7,10-tetrazacyclododec-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N,N-dimethyl-4-(1,4,7,10-tetrazacyclododec-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 140583940 |
| Molecular Formula | C20H35N5 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | N,N-dimethyl-4-(1,4,7,10-tetrazacyclododec-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CN(C)C1Cc2ccccc2C(N2CCNCCNCCNCC2)C1 |
| InChI | InChI=1S/C20H35N5/c1-24(2)18-15-17-5-3-4-6-19(17)20(16-18)25-13-11-22-9-7-21-8-10-23-12-14-25/h3-6,18,20-23H,7-16H2,1-2H3 |
| InChIKey | LVHUPTGYYDVQCM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |